C27H33FN2O4 — CID 19818474
4-[2-[1-ethyl-4-(4-fluorophenyl)-5-phenyl-2-propan-2-ylpyrrol-3-yl]ethyl-hydroxyamino]-3-hydroxybutanoic acid (PubChem CID 19818474) has the molecular formula C27H33FN2O4 and a molecular weight of 468.57 g/mol. Its IUPAC name is 4-[2-[1-ethyl-4-(4-fluorophenyl)-5-phenyl-2-propan-2-ylpyrrol-3-yl]ethyl-hydroxyamino]-3-hydroxybutanoic acid.
| Compound Name | 4-[2-[1-ethyl-4-(4-fluorophenyl)-5-phenyl-2-propan-2-ylpyrrol-3-yl]ethyl-hydroxyamino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 19818474 |
| Molecular Formula | C27H33FN2O4 |
| Molecular Weight | 468.57 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | 4-[2-[1-ethyl-4-(4-fluorophenyl)-5-phenyl-2-propan-2-ylpyrrol-3-yl]ethyl-hydroxyamino]-3-hydroxybutanoic acid |
| SMILES | CCn1c(-c2ccccc2)c(-c2ccc(F)cc2)c(CCN(O)CC(O)CC(=O)O)c1C(C)C |
| InChI | InChI=1S/C27H33FN2O4/c1-4-30-26(18(2)3)23(14-15-29(34)17-22(31)16-24(32)33)25(19-10-12-21(28)13-11-19)27(30)20-8-6-5-7-9-20/h5-13,18,22,31,34H,4,14-17H2,1-3H3,(H,32,33) |
| InChIKey | OREPIJXWHCWXPJ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 85.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.57 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|