About N-ethoxy-2-oxoacetamide
N-ethoxy-2-oxoacetamide (PubChem CID 19818586) has the molecular formula C4H7NO3
and a molecular weight of 117.10 g/mol. Its IUPAC name is N-ethoxy-2-oxoacetamide.
Molecular Properties
| Compound Name | N-ethoxy-2-oxoacetamide |
| PubChem CID | 19818586 |
| Molecular Formula | C4H7NO3 |
| Molecular Weight | 117.10 g/mol |
| Exact Mass | 117.04 |
| IUPAC Name | N-ethoxy-2-oxoacetamide |
| SMILES | CCONC(=O)C=O |
| InChI | InChI=1S/C4H7NO3/c1-2-8-5-4(7)3-6/h3H,2H2,1H3,(H,5,7) |
| InChIKey | VUWSBWGIYVQRKL-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.10 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-ethoxy-2-oxoacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethoxy-2-oxoacetamide?
The IUPAC name of N-ethoxy-2-oxoacetamide (CID 19818586) is N-ethoxy-2-oxoacetamide.
What is the SMILES notation for N-ethoxy-2-oxoacetamide?
The canonical SMILES for N-ethoxy-2-oxoacetamide is CCONC(=O)C=O.
What is the InChIKey of N-ethoxy-2-oxoacetamide?
The InChIKey is VUWSBWGIYVQRKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO3/c1-2-8-5-4(7)3-6/h3H,2H2,1H3,(H,5,7).
What are the key properties of N-ethoxy-2-oxoacetamide?
N-ethoxy-2-oxoacetamide has a molecular weight of 117.10 g/mol, XLogP of -0.75, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethoxy-2-oxoacetamide is sourced from PubChem (CID 19818586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).