C30H29Cl2F3O — CID 19819084
(E)-1-(2,4-dichlorophenyl)-3-[2-(8-phenyloctyl)-5-(trifluoromethyl)phenyl]prop-2-en-1-one (PubChem CID 19819084) has the molecular formula C30H29Cl2F3O and a molecular weight of 533.46 g/mol. Its IUPAC name is (E)-1-(2,4-dichlorophenyl)-3-[2-(8-phenyloctyl)-5-(trifluoromethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(2,4-dichlorophenyl)-3-[2-(8-phenyloctyl)-5-(trifluoromethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19819084 |
| Molecular Formula | C30H29Cl2F3O |
| Molecular Weight | 533.46 g/mol |
| Exact Mass | 532.15 |
| IUPAC Name | (E)-1-(2,4-dichlorophenyl)-3-[2-(8-phenyloctyl)-5-(trifluoromethyl)phenyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cc(C(F)(F)F)ccc1CCCCCCCCc1ccccc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C30H29Cl2F3O/c31-26-17-18-27(28(32)21-26)29(36)19-15-24-20-25(30(33,34)35)16-14-23(24)13-9-4-2-1-3-6-10-22-11-7-5-8-12-22/h5,7-8,11-12,14-21H,1-4,6,9-10,13H2/b19-15+ |
| InChIKey | NWOCRTLGQGDRHD-XDJHFCHBSA-N |
| XLogP | 10.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.46 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|