C20H30O2 — CID 19820126
1,3-bis(4,4-dimethylpent-1-en-3-yloxy)benzene (PubChem CID 19820126) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is 1,3-bis(4,4-dimethylpent-1-en-3-yloxy)benzene.
| Compound Name | 1,3-bis(4,4-dimethylpent-1-en-3-yloxy)benzene |
|---|---|
| PubChem CID | 19820126 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 1,3-bis(4,4-dimethylpent-1-en-3-yloxy)benzene |
| SMILES | C=CC(Oc1cccc(OC(C=C)C(C)(C)C)c1)C(C)(C)C |
| InChI | InChI=1S/C20H30O2/c1-9-17(19(3,4)5)21-15-12-11-13-16(14-15)22-18(10-2)20(6,7)8/h9-14,17-18H,1-2H2,3-8H3 |
| InChIKey | WTGCCUGLWKHJPU-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|