About 3-but-3-en-2-yloxyphenol
3-but-3-en-2-yloxyphenol (PubChem CID 62384342) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is 3-but-3-en-2-yloxyphenol.
Molecular Properties
| Compound Name | 3-but-3-en-2-yloxyphenol |
| PubChem CID | 62384342 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 3-but-3-en-2-yloxyphenol |
| SMILES | C=CC(C)Oc1cccc(O)c1 |
| InChI | InChI=1S/C10H12O2/c1-3-8(2)12-10-6-4-5-9(11)7-10/h3-8,11H,1H2,2H3 |
| InChIKey | BZSMPKQUDUWQIP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-but-3-en-2-yloxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-but-3-en-2-yloxyphenol?
The IUPAC name of 3-but-3-en-2-yloxyphenol (CID 62384342) is 3-but-3-en-2-yloxyphenol.
What is the SMILES notation for 3-but-3-en-2-yloxyphenol?
The canonical SMILES for 3-but-3-en-2-yloxyphenol is C=CC(C)Oc1cccc(O)c1.
What is the InChIKey of 3-but-3-en-2-yloxyphenol?
The InChIKey is BZSMPKQUDUWQIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2/c1-3-8(2)12-10-6-4-5-9(11)7-10/h3-8,11H,1H2,2H3.
What are the key properties of 3-but-3-en-2-yloxyphenol?
3-but-3-en-2-yloxyphenol has a molecular weight of 164.20 g/mol, XLogP of 2.35, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-but-3-en-2-yloxyphenol is sourced from PubChem (CID 62384342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).