C10H10F3NO3 — CID 19821152
1-(3-amino-5-hydroxy-2-methoxy-4-methylphenyl)-2,2,2-trifluoroethanone (PubChem CID 19821152) has the molecular formula C10H10F3NO3 and a molecular weight of 249.19 g/mol. Its IUPAC name is 1-(3-amino-5-hydroxy-2-methoxy-4-methylphenyl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(3-amino-5-hydroxy-2-methoxy-4-methylphenyl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 19821152 |
| Molecular Formula | C10H10F3NO3 |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 1-(3-amino-5-hydroxy-2-methoxy-4-methylphenyl)-2,2,2-trifluoroethanone |
| SMILES | COc1c(C(=O)C(F)(F)F)cc(O)c(C)c1N |
| InChI | InChI=1S/C10H10F3NO3/c1-4-6(15)3-5(8(17-2)7(4)14)9(16)10(11,12)13/h3,15H,14H2,1-2H3 |
| InChIKey | FISRNWHKQCINAD-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|