C21H24OS — CID 19824616
(E)-3-(2,4-diethylphenyl)-1-(4-ethylsulfanylphenyl)prop-2-en-1-one (PubChem CID 19824616) has the molecular formula C21H24OS and a molecular weight of 324.49 g/mol. Its IUPAC name is (E)-3-(2,4-diethylphenyl)-1-(4-ethylsulfanylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(2,4-diethylphenyl)-1-(4-ethylsulfanylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19824616 |
| Molecular Formula | C21H24OS |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | (E)-3-(2,4-diethylphenyl)-1-(4-ethylsulfanylphenyl)prop-2-en-1-one |
| SMILES | CCSc1ccc(C(=O)/C=C/c2ccc(CC)cc2CC)cc1 |
| InChI | InChI=1S/C21H24OS/c1-4-16-7-8-18(17(5-2)15-16)11-14-21(22)19-9-12-20(13-10-19)23-6-3/h7-15H,4-6H2,1-3H3/b14-11+ |
| InChIKey | ALOXNCSJDSSZAY-SDNWHVSQSA-N |
| XLogP | 5.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|