C21H26N2OS — CID 19824603
(E)-3-[3,5-bis(dimethylamino)phenyl]-1-(4-ethylsulfanylphenyl)prop-2-en-1-one (PubChem CID 19824603) has the molecular formula C21H26N2OS and a molecular weight of 354.52 g/mol. Its IUPAC name is (E)-3-[3,5-bis(dimethylamino)phenyl]-1-(4-ethylsulfanylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[3,5-bis(dimethylamino)phenyl]-1-(4-ethylsulfanylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19824603 |
| Molecular Formula | C21H26N2OS |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | (E)-3-[3,5-bis(dimethylamino)phenyl]-1-(4-ethylsulfanylphenyl)prop-2-en-1-one |
| SMILES | CCSc1ccc(C(=O)/C=C/c2cc(N(C)C)cc(N(C)C)c2)cc1 |
| InChI | InChI=1S/C21H26N2OS/c1-6-25-20-10-8-17(9-11-20)21(24)12-7-16-13-18(22(2)3)15-19(14-16)23(4)5/h7-15H,6H2,1-5H3/b12-7+ |
| InChIKey | HHUVLNGOSKJNEN-KPKJPENVSA-N |
| XLogP | 4.83 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|