C22H29N2O5- — CID 19825209
N-[2-[4-(2-ethoxyethoxy)phenyl]ethyl]-3-ethylpyridine-2-carboxamide acetate (PubChem CID 19825209) has the molecular formula C22H29N2O5- and a molecular weight of 401.48 g/mol. Its IUPAC name is N-[2-[4-(2-ethoxyethoxy)phenyl]ethyl]-3-ethylpyridine-2-carboxamide acetate.
| Compound Name | N-[2-[4-(2-ethoxyethoxy)phenyl]ethyl]-3-ethylpyridine-2-carboxamide acetate |
|---|---|
| PubChem CID | 19825209 |
| Molecular Formula | C22H29N2O5- |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | N-[2-[4-(2-ethoxyethoxy)phenyl]ethyl]-3-ethylpyridine-2-carboxamide acetate |
| SMILES | CC(=O)[O-].CCOCCOc1ccc(CCNC(=O)c2ncccc2CC)cc1 |
| InChI | InChI=1S/C20H26N2O3.C2H4O2/c1-3-17-6-5-12-21-19(17)20(23)22-13-11-16-7-9-18(10-8-16)25-15-14-24-4-2;1-2(3)4/h5-10,12H,3-4,11,13-15H2,1-2H3,(H,22,23);1H3,(H,3,4)/p-1 |
| InChIKey | GTEZHSPCTSBOBY-UHFFFAOYSA-M |
| XLogP | 1.79 |
| TPSA | 100.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|