C21H27NO5S — CID 67928368
ethyl 2-[2-[2-[4-(2-ethoxyethoxy)phenyl]ethylcarbamoyl]thiophen-3-yl]acetate (PubChem CID 67928368) has the molecular formula C21H27NO5S and a molecular weight of 405.52 g/mol. Its IUPAC name is ethyl 2-[2-[2-[4-(2-ethoxyethoxy)phenyl]ethylcarbamoyl]thiophen-3-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[4-(2-ethoxyethoxy)phenyl]ethylcarbamoyl]thiophen-3-yl]acetate |
|---|---|
| PubChem CID | 67928368 |
| Molecular Formula | C21H27NO5S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | ethyl 2-[2-[2-[4-(2-ethoxyethoxy)phenyl]ethylcarbamoyl]thiophen-3-yl]acetate |
| SMILES | CCOCCOc1ccc(CCNC(=O)c2sccc2CC(=O)OCC)cc1 |
| InChI | InChI=1S/C21H27NO5S/c1-3-25-12-13-27-18-7-5-16(6-8-18)9-11-22-21(24)20-17(10-14-28-20)15-19(23)26-4-2/h5-8,10,14H,3-4,9,11-13,15H2,1-2H3,(H,22,24) |
| InChIKey | RVRYGURWNBZINZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|