C19H21N5O — CID 19826090
2-amino-5-[1-hydroxy-2-[1-(1H-indol-3-yl)propan-2-ylamino]ethyl]pyridine-3-carbonitrile (PubChem CID 19826090) has the molecular formula C19H21N5O and a molecular weight of 335.41 g/mol. Its IUPAC name is 2-amino-5-[1-hydroxy-2-[1-(1H-indol-3-yl)propan-2-ylamino]ethyl]pyridine-3-carbonitrile.
| Compound Name | 2-amino-5-[1-hydroxy-2-[1-(1H-indol-3-yl)propan-2-ylamino]ethyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19826090 |
| Molecular Formula | C19H21N5O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 2-amino-5-[1-hydroxy-2-[1-(1H-indol-3-yl)propan-2-ylamino]ethyl]pyridine-3-carbonitrile |
| SMILES | CC(Cc1c[nH]c2ccccc12)NCC(O)c1cnc(N)c(C#N)c1 |
| InChI | InChI=1S/C19H21N5O/c1-12(6-14-9-23-17-5-3-2-4-16(14)17)22-11-18(25)15-7-13(8-20)19(21)24-10-15/h2-5,7,9-10,12,18,22-23,25H,6,11H2,1H3,(H2,21,24) |
| InChIKey | ZFEDQBGMXQRWLA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 110.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |