C19H23NO3 — CID 19826983
ethyl 1-[2-(1H-inden-2-yl)acetyl]piperidine-2-carboxylate (PubChem CID 19826983) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is ethyl 1-[2-(1H-inden-2-yl)acetyl]piperidine-2-carboxylate.
| Compound Name | ethyl 1-[2-(1H-inden-2-yl)acetyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 19826983 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | ethyl 1-[2-(1H-inden-2-yl)acetyl]piperidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCCCN1C(=O)CC1=Cc2ccccc2C1 |
| InChI | InChI=1S/C19H23NO3/c1-2-23-19(22)17-9-5-6-10-20(17)18(21)13-14-11-15-7-3-4-8-16(15)12-14/h3-4,7-8,11,17H,2,5-6,9-10,12-13H2,1H3 |
| InChIKey | UMSMYLNMLHBBTQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |