C22H24N2O3S — CID 18645794
(2S)-3-[1-[2-(1H-inden-2-yl)acetyl]piperidine-2-carbonyl]-4-sulfanylidenepyrrolidine-2-carbaldehyde (PubChem CID 18645794) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is (2S)-3-[1-[2-(1H-inden-2-yl)acetyl]piperidine-2-carbonyl]-4-sulfanylidenepyrrolidine-2-carbaldehyde.
| Compound Name | (2S)-3-[1-[2-(1H-inden-2-yl)acetyl]piperidine-2-carbonyl]-4-sulfanylidenepyrrolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 18645794 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | (2S)-3-[1-[2-(1H-inden-2-yl)acetyl]piperidine-2-carbonyl]-4-sulfanylidenepyrrolidine-2-carbaldehyde |
| SMILES | O=C[C@H]1NCC(=S)C1C(=O)C1CCCCN1C(=O)CC1=Cc2ccccc2C1 |
| InChI | InChI=1S/C22H24N2O3S/c25-13-17-21(19(28)12-23-17)22(27)18-7-3-4-8-24(18)20(26)11-14-9-15-5-1-2-6-16(15)10-14/h1-2,5-6,9,13,17-18,21,23H,3-4,7-8,10-12H2/t17-,18?,21?/m1/s1 |
| InChIKey | DMYQSNVNIHEREG-MPQSDHOMSA-N |
| XLogP | 2.12 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|