C23H26N2O5S — CID 18645778
methyl (2S)-1-[(2S)-3-[2-(5-methoxy-1H-inden-2-yl)acetyl]-4-sulfanylidenepyrrolidine-2-carbonyl]pyrrolidine-2-carboxylate (PubChem CID 18645778) has the molecular formula C23H26N2O5S and a molecular weight of 442.54 g/mol. Its IUPAC name is methyl (2S)-1-[(2S)-3-[2-(5-methoxy-1H-inden-2-yl)acetyl]-4-sulfanylidenepyrrolidine-2-carbonyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-[(2S)-3-[2-(5-methoxy-1H-inden-2-yl)acetyl]-4-sulfanylidenepyrrolidine-2-carbonyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 18645778 |
| Molecular Formula | C23H26N2O5S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | methyl (2S)-1-[(2S)-3-[2-(5-methoxy-1H-inden-2-yl)acetyl]-4-sulfanylidenepyrrolidine-2-carbonyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCN1C(=O)[C@H]1NCC(=S)C1C(=O)CC1=Cc2cc(OC)ccc2C1 |
| InChI | InChI=1S/C23H26N2O5S/c1-29-16-6-5-14-8-13(9-15(14)11-16)10-18(26)20-19(31)12-24-21(20)22(27)25-7-3-4-17(25)23(28)30-2/h5-6,9,11,17,20-21,24H,3-4,7-8,10,12H2,1-2H3/t17-,20?,21-/m0/s1 |
| InChIKey | OXEPJBDCLOGWJA-ZPWCZAOQSA-N |
| XLogP | 1.72 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|