C23H23NO5 — CID 86625136
methyl (2S)-1-[(2-methoxynaphtho[1,2-f][1,3]benzodioxol-5-yl)methyl]pyrrolidine-2-carboxylate (PubChem CID 86625136) has the molecular formula C23H23NO5 and a molecular weight of 393.44 g/mol. Its IUPAC name is methyl (2S)-1-[(2-methoxynaphtho[1,2-f][1,3]benzodioxol-5-yl)methyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-[(2-methoxynaphtho[1,2-f][1,3]benzodioxol-5-yl)methyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 86625136 |
| Molecular Formula | C23H23NO5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | methyl (2S)-1-[(2-methoxynaphtho[1,2-f][1,3]benzodioxol-5-yl)methyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCN1Cc1cc2cc3c(cc2c2cc(OC)ccc12)OCO3 |
| InChI | InChI=1S/C23H23NO5/c1-26-16-5-6-17-15(12-24-7-3-4-20(24)23(25)27-2)8-14-9-21-22(29-13-28-21)11-18(14)19(17)10-16/h5-6,8-11,20H,3-4,7,12-13H2,1-2H3/t20-/m0/s1 |
| InChIKey | OCDHFJCQCSDWGR-FQEVSTJZSA-N |
| XLogP | 3.87 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|