C22H21NO5 — CID 74258749
1-[(2-hydroxynaphtho[1,2-f][1,3]benzodioxol-5-yl)methyl]piperidine-2-carboxylic acid (PubChem CID 74258749) has the molecular formula C22H21NO5 and a molecular weight of 379.41 g/mol. Its IUPAC name is 1-[(2-hydroxynaphtho[1,2-f][1,3]benzodioxol-5-yl)methyl]piperidine-2-carboxylic acid.
| Compound Name | 1-[(2-hydroxynaphtho[1,2-f][1,3]benzodioxol-5-yl)methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 74258749 |
| Molecular Formula | C22H21NO5 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 1-[(2-hydroxynaphtho[1,2-f][1,3]benzodioxol-5-yl)methyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1Cc1cc2cc3c(cc2c2cc(O)ccc12)OCO3 |
| InChI | InChI=1S/C22H21NO5/c24-15-4-5-16-14(11-23-6-2-1-3-19(23)22(25)26)7-13-8-20-21(28-12-27-20)10-17(13)18(16)9-15/h4-5,7-10,19,24H,1-3,6,11-12H2,(H,25,26) |
| InChIKey | PQKUKIRPFOEXTI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|