C28H27NO4 — CID 86625133
[(2S)-1-[(2-phenylmethoxynaphtho[1,2-f][1,3]benzodioxol-5-yl)methyl]pyrrolidin-2-yl]methanol (PubChem CID 86625133) has the molecular formula C28H27NO4 and a molecular weight of 441.53 g/mol. Its IUPAC name is [(2S)-1-[(2-phenylmethoxynaphtho[1,2-f][1,3]benzodioxol-5-yl)methyl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2S)-1-[(2-phenylmethoxynaphtho[1,2-f][1,3]benzodioxol-5-yl)methyl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 86625133 |
| Molecular Formula | C28H27NO4 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | [(2S)-1-[(2-phenylmethoxynaphtho[1,2-f][1,3]benzodioxol-5-yl)methyl]pyrrolidin-2-yl]methanol |
| SMILES | OC[C@@H]1CCCN1Cc1cc2cc3c(cc2c2cc(OCc4ccccc4)ccc12)OCO3 |
| InChI | InChI=1S/C28H27NO4/c30-16-22-7-4-10-29(22)15-21-11-20-12-27-28(33-18-32-27)14-25(20)26-13-23(8-9-24(21)26)31-17-19-5-2-1-3-6-19/h1-3,5-6,8-9,11-14,22,30H,4,7,10,15-18H2/t22-/m0/s1 |
| InChIKey | IFFQXOKSHXYYFZ-QFIPXVFZSA-N |
| XLogP | 5.26 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|