C22H19NO6 — CID 87762915
(2S)-1-(2-methoxynaphtho[2,1-f][1,3]benzodioxole-5-carbonyl)pyrrolidine-2-carboxylic acid (PubChem CID 87762915) has the molecular formula C22H19NO6 and a molecular weight of 393.40 g/mol. Its IUPAC name is (2S)-1-(2-methoxynaphtho[2,1-f][1,3]benzodioxole-5-carbonyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-(2-methoxynaphtho[2,1-f][1,3]benzodioxole-5-carbonyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 87762915 |
| Molecular Formula | C22H19NO6 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | (2S)-1-(2-methoxynaphtho[2,1-f][1,3]benzodioxole-5-carbonyl)pyrrolidine-2-carboxylic acid |
| SMILES | COc1ccc2c(C(=O)N3CCC[C@H]3C(=O)O)cc3cc4c(cc3c2c1)OCO4 |
| InChI | InChI=1S/C22H19NO6/c1-27-13-4-5-14-16(9-13)15-10-20-19(28-11-29-20)8-12(15)7-17(14)21(24)23-6-2-3-18(23)22(25)26/h4-5,7-10,18H,2-3,6,11H2,1H3,(H,25,26)/t18-/m0/s1 |
| InChIKey | RYTBUZJSNZRHQA-SFHVURJKSA-N |
| XLogP | 3.42 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|