C23H24INO4 — CID 132597060
[2-(iodomethyl)pyrrolidin-1-yl]-(2,3,6-trimethoxyphenanthren-9-yl)methanone (PubChem CID 132597060) has the molecular formula C23H24INO4 and a molecular weight of 505.35 g/mol. Its IUPAC name is [2-(iodomethyl)pyrrolidin-1-yl]-(2,3,6-trimethoxyphenanthren-9-yl)methanone.
| Compound Name | [2-(iodomethyl)pyrrolidin-1-yl]-(2,3,6-trimethoxyphenanthren-9-yl)methanone |
|---|---|
| PubChem CID | 132597060 |
| Molecular Formula | C23H24INO4 |
| Molecular Weight | 505.35 g/mol |
| Exact Mass | 505.08 |
| IUPAC Name | [2-(iodomethyl)pyrrolidin-1-yl]-(2,3,6-trimethoxyphenanthren-9-yl)methanone |
| SMILES | COc1ccc2c(C(=O)N3CCCC3CI)cc3cc(OC)c(OC)cc3c2c1 |
| InChI | InChI=1S/C23H24INO4/c1-27-16-6-7-17-19(11-16)18-12-22(29-3)21(28-2)10-14(18)9-20(17)23(26)25-8-4-5-15(25)13-24/h6-7,9-12,15H,4-5,8,13H2,1-3H3 |
| InChIKey | MZXYZRSMMGEYJE-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.35 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|