C27H25ClN2O3 — CID 16749249
1-(4-chlorophenyl)-4-[(2-methoxynaphtho[2,1-f][1,3]benzodioxol-5-yl)methyl]piperazine (PubChem CID 16749249) has the molecular formula C27H25ClN2O3 and a molecular weight of 460.96 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4-[(2-methoxynaphtho[2,1-f][1,3]benzodioxol-5-yl)methyl]piperazine.
| Compound Name | 1-(4-chlorophenyl)-4-[(2-methoxynaphtho[2,1-f][1,3]benzodioxol-5-yl)methyl]piperazine |
|---|---|
| PubChem CID | 16749249 |
| Molecular Formula | C27H25ClN2O3 |
| Molecular Weight | 460.96 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 1-(4-chlorophenyl)-4-[(2-methoxynaphtho[2,1-f][1,3]benzodioxol-5-yl)methyl]piperazine |
| SMILES | COc1ccc2c(CN3CCN(c4ccc(Cl)cc4)CC3)cc3cc4c(cc3c2c1)OCO4 |
| InChI | InChI=1S/C27H25ClN2O3/c1-31-22-6-7-23-19(12-18-13-26-27(33-17-32-26)15-24(18)25(23)14-22)16-29-8-10-30(11-9-29)21-4-2-20(28)3-5-21/h2-7,12-15H,8-11,16-17H2,1H3 |
| InChIKey | UUIDKOIKSCZIDH-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.96 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|