C24H30N2O4S — CID 22852963
[(2S)-2-[(2S)-2-(diethoxymethyl)pyrrolidine-1-carbonyl]-4-sulfanylidenepyrrolidin-3-yl]-(1H-inden-2-yl)methanone (PubChem CID 22852963) has the molecular formula C24H30N2O4S and a molecular weight of 442.58 g/mol. Its IUPAC name is [(2S)-2-[(2S)-2-(diethoxymethyl)pyrrolidine-1-carbonyl]-4-sulfanylidenepyrrolidin-3-yl]-(1H-inden-2-yl)methanone.
| Compound Name | [(2S)-2-[(2S)-2-(diethoxymethyl)pyrrolidine-1-carbonyl]-4-sulfanylidenepyrrolidin-3-yl]-(1H-inden-2-yl)methanone |
|---|---|
| PubChem CID | 22852963 |
| Molecular Formula | C24H30N2O4S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | [(2S)-2-[(2S)-2-(diethoxymethyl)pyrrolidine-1-carbonyl]-4-sulfanylidenepyrrolidin-3-yl]-(1H-inden-2-yl)methanone |
| SMILES | CCOC(OCC)[C@@H]1CCCN1C(=O)[C@H]1NCC(=S)C1C(=O)C1=Cc2ccccc2C1 |
| InChI | InChI=1S/C24H30N2O4S/c1-3-29-24(30-4-2)18-10-7-11-26(18)23(28)21-20(19(31)14-25-21)22(27)17-12-15-8-5-6-9-16(15)13-17/h5-6,8-9,12,18,20-21,24-25H,3-4,7,10-11,13-14H2,1-2H3/t18-,20?,21-/m0/s1 |
| InChIKey | AHXGOYIHUDESAP-QJQMAANRSA-N |
| XLogP | 2.54 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|