C23H30N2O4S — CID 22853079
[(4R)-4-(diethoxymethyl)-1,3-thiazolidin-3-yl]-[(2S)-1-(1H-indene-2-carbonyl)pyrrolidin-2-yl]methanone (PubChem CID 22853079) has the molecular formula C23H30N2O4S and a molecular weight of 430.57 g/mol. Its IUPAC name is [(4R)-4-(diethoxymethyl)-1,3-thiazolidin-3-yl]-[(2S)-1-(1H-indene-2-carbonyl)pyrrolidin-2-yl]methanone.
| Compound Name | [(4R)-4-(diethoxymethyl)-1,3-thiazolidin-3-yl]-[(2S)-1-(1H-indene-2-carbonyl)pyrrolidin-2-yl]methanone |
|---|---|
| PubChem CID | 22853079 |
| Molecular Formula | C23H30N2O4S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | [(4R)-4-(diethoxymethyl)-1,3-thiazolidin-3-yl]-[(2S)-1-(1H-indene-2-carbonyl)pyrrolidin-2-yl]methanone |
| SMILES | CCOC(OCC)[C@@H]1CSCN1C(=O)[C@@H]1CCCN1C(=O)C1=Cc2ccccc2C1 |
| InChI | InChI=1S/C23H30N2O4S/c1-3-28-23(29-4-2)20-14-30-15-25(20)22(27)19-10-7-11-24(19)21(26)18-12-16-8-5-6-9-17(16)13-18/h5-6,8-9,12,19-20,23H,3-4,7,10-11,13-15H2,1-2H3/t19-,20-/m0/s1 |
| InChIKey | BOKZAYZBHFAKFB-PMACEKPBSA-N |
| XLogP | 2.92 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|