C26H26N4O2 — CID 19828299
2-[(4-anilinoanilino)oxymethyl]-4-N-(4-methoxyphenyl)benzene-1,4-diamine (PubChem CID 19828299) has the molecular formula C26H26N4O2 and a molecular weight of 426.52 g/mol. Its IUPAC name is 2-[(4-anilinoanilino)oxymethyl]-4-N-(4-methoxyphenyl)benzene-1,4-diamine.
| Compound Name | 2-[(4-anilinoanilino)oxymethyl]-4-N-(4-methoxyphenyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 19828299 |
| Molecular Formula | C26H26N4O2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 2-[(4-anilinoanilino)oxymethyl]-4-N-(4-methoxyphenyl)benzene-1,4-diamine |
| SMILES | COc1ccc(Nc2ccc(N)c(CONc3ccc(Nc4ccccc4)cc3)c2)cc1 |
| InChI | InChI=1S/C26H26N4O2/c1-31-25-14-11-22(12-15-25)29-24-13-16-26(27)19(17-24)18-32-30-23-9-7-21(8-10-23)28-20-5-3-2-4-6-20/h2-17,28-30H,18,27H2,1H3 |
| InChIKey | JFPRURTVBRYFMA-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|