C21H26O3 — CID 19832850
5-tert-butyl-3-(4-tert-butylphenyl)-2-hydroxybenzoic acid (PubChem CID 19832850) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is 5-tert-butyl-3-(4-tert-butylphenyl)-2-hydroxybenzoic acid.
| Compound Name | 5-tert-butyl-3-(4-tert-butylphenyl)-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 19832850 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 5-tert-butyl-3-(4-tert-butylphenyl)-2-hydroxybenzoic acid |
| SMILES | CC(C)(C)c1ccc(-c2cc(C(C)(C)C)cc(C(=O)O)c2O)cc1 |
| InChI | InChI=1S/C21H26O3/c1-20(2,3)14-9-7-13(8-10-14)16-11-15(21(4,5)6)12-17(18(16)22)19(23)24/h7-12,22H,1-6H3,(H,23,24) |
| InChIKey | LRIQVGGDQTZKRR-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |