C33H44N2O — CID 19834787
2-(4-dec-9-enoxyphenyl)-5-[4-(4-methylhexyl)phenyl]pyrimidine (PubChem CID 19834787) has the molecular formula C33H44N2O and a molecular weight of 484.73 g/mol. Its IUPAC name is 2-(4-dec-9-enoxyphenyl)-5-[4-(4-methylhexyl)phenyl]pyrimidine.
| Compound Name | 2-(4-dec-9-enoxyphenyl)-5-[4-(4-methylhexyl)phenyl]pyrimidine |
|---|---|
| PubChem CID | 19834787 |
| Molecular Formula | C33H44N2O |
| Molecular Weight | 484.73 g/mol |
| Exact Mass | 484.35 |
| IUPAC Name | 2-(4-dec-9-enoxyphenyl)-5-[4-(4-methylhexyl)phenyl]pyrimidine |
| SMILES | C=CCCCCCCCCOc1ccc(-c2ncc(-c3ccc(CCCC(C)CC)cc3)cn2)cc1 |
| InChI | InChI=1S/C33H44N2O/c1-4-6-7-8-9-10-11-12-24-36-32-22-20-30(21-23-32)33-34-25-31(26-35-33)29-18-16-28(17-19-29)15-13-14-27(3)5-2/h4,16-23,25-27H,1,5-15,24H2,2-3H3 |
| InChIKey | WPPMIWAAKKBDAM-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.73 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|