C25H36N2O2 — CID 19834831
2-(4-dec-9-enoxyphenyl)-5-(2-methylbutoxy)pyrimidine (PubChem CID 19834831) has the molecular formula C25H36N2O2 and a molecular weight of 396.58 g/mol. Its IUPAC name is 2-(4-dec-9-enoxyphenyl)-5-(2-methylbutoxy)pyrimidine.
| Compound Name | 2-(4-dec-9-enoxyphenyl)-5-(2-methylbutoxy)pyrimidine |
|---|---|
| PubChem CID | 19834831 |
| Molecular Formula | C25H36N2O2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | 2-(4-dec-9-enoxyphenyl)-5-(2-methylbutoxy)pyrimidine |
| SMILES | C=CCCCCCCCCOc1ccc(-c2ncc(OCC(C)CC)cn2)cc1 |
| InChI | InChI=1S/C25H36N2O2/c1-4-6-7-8-9-10-11-12-17-28-23-15-13-22(14-16-23)25-26-18-24(19-27-25)29-20-21(3)5-2/h4,13-16,18-19,21H,1,5-12,17,20H2,2-3H3 |
| InChIKey | KWIHMDIGZWYCFC-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|