C23H25ClN2O3 — CID 19838027
5-chloro-3-[2-(4-ethylpiperazin-1-yl)-2-oxoethyl]-3-(4-methylphenyl)-1-benzofuran-2-one (PubChem CID 19838027) has the molecular formula C23H25ClN2O3 and a molecular weight of 412.92 g/mol. Its IUPAC name is 5-chloro-3-[2-(4-ethylpiperazin-1-yl)-2-oxoethyl]-3-(4-methylphenyl)-1-benzofuran-2-one.
| Compound Name | 5-chloro-3-[2-(4-ethylpiperazin-1-yl)-2-oxoethyl]-3-(4-methylphenyl)-1-benzofuran-2-one |
|---|---|
| PubChem CID | 19838027 |
| Molecular Formula | C23H25ClN2O3 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 5-chloro-3-[2-(4-ethylpiperazin-1-yl)-2-oxoethyl]-3-(4-methylphenyl)-1-benzofuran-2-one |
| SMILES | CCN1CCN(C(=O)CC2(c3ccc(C)cc3)C(=O)Oc3ccc(Cl)cc32)CC1 |
| InChI | InChI=1S/C23H25ClN2O3/c1-3-25-10-12-26(13-11-25)21(27)15-23(17-6-4-16(2)5-7-17)19-14-18(24)8-9-20(19)29-22(23)28/h4-9,14H,3,10-13,15H2,1-2H3 |
| InChIKey | BVTXJPFTMUYZMP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|