C26H21ClF3N3O3 — CID 14303499
5-chloro-3-[2-oxo-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethyl]-3-phenyl-1-benzofuran-2-one (PubChem CID 14303499) has the molecular formula C26H21ClF3N3O3 and a molecular weight of 515.92 g/mol. Its IUPAC name is 5-chloro-3-[2-oxo-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethyl]-3-phenyl-1-benzofuran-2-one.
| Compound Name | 5-chloro-3-[2-oxo-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethyl]-3-phenyl-1-benzofuran-2-one |
|---|---|
| PubChem CID | 14303499 |
| Molecular Formula | C26H21ClF3N3O3 |
| Molecular Weight | 515.92 g/mol |
| Exact Mass | 515.12 |
| IUPAC Name | 5-chloro-3-[2-oxo-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]ethyl]-3-phenyl-1-benzofuran-2-one |
| SMILES | O=C(CC1(c2ccccc2)C(=O)Oc2ccc(Cl)cc21)N1CCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C26H21ClF3N3O3/c27-19-7-8-21-20(14-19)25(24(35)36-21,17-4-2-1-3-5-17)15-23(34)33-12-10-32(11-13-33)22-9-6-18(16-31-22)26(28,29)30/h1-9,14,16H,10-13,15H2 |
| InChIKey | ODXUXPLKFODWNK-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.92 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|