C17H14ClF3IN3O — CID 38917582
(5-chloro-2-iodophenyl)-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methanone (PubChem CID 38917582) has the molecular formula C17H14ClF3IN3O and a molecular weight of 495.67 g/mol. Its IUPAC name is (5-chloro-2-iodophenyl)-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methanone.
| Compound Name | (5-chloro-2-iodophenyl)-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 38917582 |
| Molecular Formula | C17H14ClF3IN3O |
| Molecular Weight | 495.67 g/mol |
| Exact Mass | 494.98 |
| IUPAC Name | (5-chloro-2-iodophenyl)-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1cc(Cl)ccc1I)N1CCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C17H14ClF3IN3O/c18-12-2-3-14(22)13(9-12)16(26)25-7-5-24(6-8-25)15-4-1-11(10-23-15)17(19,20)21/h1-4,9-10H,5-8H2 |
| InChIKey | NIYWPVUYAYPESS-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.67 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|