C22H36N2O2 — CID 19839770
5-pentyl-2-[4-(5-propyl-1,3-dioxan-2-yl)cyclohexyl]pyrimidine (PubChem CID 19839770) has the molecular formula C22H36N2O2 and a molecular weight of 360.54 g/mol. Its IUPAC name is 5-pentyl-2-[4-(5-propyl-1,3-dioxan-2-yl)cyclohexyl]pyrimidine.
| Compound Name | 5-pentyl-2-[4-(5-propyl-1,3-dioxan-2-yl)cyclohexyl]pyrimidine |
|---|---|
| PubChem CID | 19839770 |
| Molecular Formula | C22H36N2O2 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.28 |
| IUPAC Name | 5-pentyl-2-[4-(5-propyl-1,3-dioxan-2-yl)cyclohexyl]pyrimidine |
| SMILES | CCCCCc1cnc(C2CCC(C3OCC(CCC)CO3)CC2)nc1 |
| InChI | InChI=1S/C22H36N2O2/c1-3-5-6-8-17-13-23-21(24-14-17)19-9-11-20(12-10-19)22-25-15-18(7-4-2)16-26-22/h13-14,18-20,22H,3-12,15-16H2,1-2H3 |
| InChIKey | UYGRXLDCEUJEPS-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|