C21H28Cl2N2O3S — CID 19844868
N-[4-chloro-2-(3-chloropropoxy)phenyl]-N-(pyridin-4-ylmethyl)hexane-1-sulfonamide (PubChem CID 19844868) has the molecular formula C21H28Cl2N2O3S and a molecular weight of 459.44 g/mol. Its IUPAC name is N-[4-chloro-2-(3-chloropropoxy)phenyl]-N-(pyridin-4-ylmethyl)hexane-1-sulfonamide.
| Compound Name | N-[4-chloro-2-(3-chloropropoxy)phenyl]-N-(pyridin-4-ylmethyl)hexane-1-sulfonamide |
|---|---|
| PubChem CID | 19844868 |
| Molecular Formula | C21H28Cl2N2O3S |
| Molecular Weight | 459.44 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | N-[4-chloro-2-(3-chloropropoxy)phenyl]-N-(pyridin-4-ylmethyl)hexane-1-sulfonamide |
| SMILES | CCCCCCS(=O)(=O)N(Cc1ccncc1)c1ccc(Cl)cc1OCCCCl |
| InChI | InChI=1S/C21H28Cl2N2O3S/c1-2-3-4-5-15-29(26,27)25(17-18-9-12-24-13-10-18)20-8-7-19(23)16-21(20)28-14-6-11-22/h7-10,12-13,16H,2-6,11,14-15,17H2,1H3 |
| InChIKey | CEUASGOVHFWFRZ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.44 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|