C9H10BrN3O3 — CID 19845044
N-(4-bromo-2-methoxyphenyl)-2-hydrazinyl-2-oxoacetamide (PubChem CID 19845044) has the molecular formula C9H10BrN3O3 and a molecular weight of 288.10 g/mol. Its IUPAC name is N-(4-bromo-2-methoxyphenyl)-2-hydrazinyl-2-oxoacetamide.
| Compound Name | N-(4-bromo-2-methoxyphenyl)-2-hydrazinyl-2-oxoacetamide |
|---|---|
| PubChem CID | 19845044 |
| Molecular Formula | C9H10BrN3O3 |
| Molecular Weight | 288.10 g/mol |
| Exact Mass | 286.99 |
| IUPAC Name | N-(4-bromo-2-methoxyphenyl)-2-hydrazinyl-2-oxoacetamide |
| SMILES | COc1cc(Br)ccc1NC(=O)C(=O)NN |
| InChI | InChI=1S/C9H10BrN3O3/c1-16-7-4-5(10)2-3-6(7)12-8(14)9(15)13-11/h2-4H,11H2,1H3,(H,12,14)(H,13,15) |
| InChIKey | FJCYEOITBGLDGC-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.10 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|