About S-(2-aminoethyl) N-pentan-3-ylcarbamothioate
S-(2-aminoethyl) N-pentan-3-ylcarbamothioate (PubChem CID 19851838) has the molecular formula C8H18N2OS
and a molecular weight of 190.31 g/mol. Its IUPAC name is S-(2-aminoethyl) N-pentan-3-ylcarbamothioate.
Molecular Properties
| Compound Name | S-(2-aminoethyl) N-pentan-3-ylcarbamothioate |
| PubChem CID | 19851838 |
| Molecular Formula | C8H18N2OS |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | S-(2-aminoethyl) N-pentan-3-ylcarbamothioate |
| SMILES | CCC(CC)NC(=O)SCCN |
| InChI | InChI=1S/C8H18N2OS/c1-3-7(4-2)10-8(11)12-6-5-9/h7H,3-6,9H2,1-2H3,(H,10,11) |
| InChIKey | QKFCFLDOJQVTSB-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2-aminoethyl) N-pentan-3-ylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2-aminoethyl) N-pentan-3-ylcarbamothioate?
The IUPAC name of S-(2-aminoethyl) N-pentan-3-ylcarbamothioate (CID 19851838) is S-(2-aminoethyl) N-pentan-3-ylcarbamothioate.
What is the SMILES notation for S-(2-aminoethyl) N-pentan-3-ylcarbamothioate?
The canonical SMILES for S-(2-aminoethyl) N-pentan-3-ylcarbamothioate is CCC(CC)NC(=O)SCCN.
What is the InChIKey of S-(2-aminoethyl) N-pentan-3-ylcarbamothioate?
The InChIKey is QKFCFLDOJQVTSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2OS/c1-3-7(4-2)10-8(11)12-6-5-9/h7H,3-6,9H2,1-2H3,(H,10,11).
What are the key properties of S-(2-aminoethyl) N-pentan-3-ylcarbamothioate?
S-(2-aminoethyl) N-pentan-3-ylcarbamothioate has a molecular weight of 190.31 g/mol, XLogP of 1.58, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2-aminoethyl) N-pentan-3-ylcarbamothioate is sourced from PubChem (CID 19851838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).