C22H19ClF3N3O5 — CID 19852590
ethyl 5-(4-chlorophenyl)-2-[formyl-[4-(trifluoromethoxy)phenyl]carbamoyl]-4-methyl-3H-pyrazole-4-carboxylate (PubChem CID 19852590) has the molecular formula C22H19ClF3N3O5 and a molecular weight of 497.86 g/mol. Its IUPAC name is ethyl 5-(4-chlorophenyl)-2-[formyl-[4-(trifluoromethoxy)phenyl]carbamoyl]-4-methyl-3H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-(4-chlorophenyl)-2-[formyl-[4-(trifluoromethoxy)phenyl]carbamoyl]-4-methyl-3H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 19852590 |
| Molecular Formula | C22H19ClF3N3O5 |
| Molecular Weight | 497.86 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | ethyl 5-(4-chlorophenyl)-2-[formyl-[4-(trifluoromethoxy)phenyl]carbamoyl]-4-methyl-3H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)C1(C)CN(C(=O)N(C=O)c2ccc(OC(F)(F)F)cc2)N=C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H19ClF3N3O5/c1-3-33-19(31)21(2)12-29(27-18(21)14-4-6-15(23)7-5-14)20(32)28(13-30)16-8-10-17(11-9-16)34-22(24,25)26/h4-11,13H,3,12H2,1-2H3 |
| InChIKey | XABGQIIVQNAVFA-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 88.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.86 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|