C28H21ClF6N4O5S — CID 19852713
ethyl 5-[3-chloro-4-(trifluoromethyl)phenyl]-4-methyl-2-[(2-nitrophenyl)sulfanyl-[4-(trifluoromethyl)phenyl]carbamoyl]-3H-pyrazole-4-carboxylate (PubChem CID 19852713) has the molecular formula C28H21ClF6N4O5S and a molecular weight of 675.01 g/mol. Its IUPAC name is ethyl 5-[3-chloro-4-(trifluoromethyl)phenyl]-4-methyl-2-[(2-nitrophenyl)sulfanyl-[4-(trifluoromethyl)phenyl]carbamoyl]-3H-pyrazole-4-carboxylate.
| Compound Name | ethyl 5-[3-chloro-4-(trifluoromethyl)phenyl]-4-methyl-2-[(2-nitrophenyl)sulfanyl-[4-(trifluoromethyl)phenyl]carbamoyl]-3H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 19852713 |
| Molecular Formula | C28H21ClF6N4O5S |
| Molecular Weight | 675.01 g/mol |
| Exact Mass | 674.08 |
| IUPAC Name | ethyl 5-[3-chloro-4-(trifluoromethyl)phenyl]-4-methyl-2-[(2-nitrophenyl)sulfanyl-[4-(trifluoromethyl)phenyl]carbamoyl]-3H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)C1(C)CN(C(=O)N(Sc2ccccc2[N+](=O)[O-])c2ccc(C(F)(F)F)cc2)N=C1c1ccc(C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C28H21ClF6N4O5S/c1-3-44-24(40)26(2)15-37(36-23(26)16-8-13-19(20(29)14-16)28(33,34)35)25(41)38(18-11-9-17(10-12-18)27(30,31)32)45-22-7-5-4-6-21(22)39(42)43/h4-14H,3,15H2,1-2H3 |
| InChIKey | SZMXNUWIYMXAFL-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 105.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.01 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|