C21H18BrClF3N3O — CID 19852722
N-(4-bromophenyl)-5-[3-chloro-4-(trifluoromethyl)phenyl]-4-methyl-4-prop-2-enyl-3H-pyrazole-2-carboxamide (PubChem CID 19852722) has the molecular formula C21H18BrClF3N3O and a molecular weight of 500.75 g/mol. Its IUPAC name is N-(4-bromophenyl)-5-[3-chloro-4-(trifluoromethyl)phenyl]-4-methyl-4-prop-2-enyl-3H-pyrazole-2-carboxamide.
| Compound Name | N-(4-bromophenyl)-5-[3-chloro-4-(trifluoromethyl)phenyl]-4-methyl-4-prop-2-enyl-3H-pyrazole-2-carboxamide |
|---|---|
| PubChem CID | 19852722 |
| Molecular Formula | C21H18BrClF3N3O |
| Molecular Weight | 500.75 g/mol |
| Exact Mass | 499.03 |
| IUPAC Name | N-(4-bromophenyl)-5-[3-chloro-4-(trifluoromethyl)phenyl]-4-methyl-4-prop-2-enyl-3H-pyrazole-2-carboxamide |
| SMILES | C=CCC1(C)CN(C(=O)Nc2ccc(Br)cc2)N=C1c1ccc(C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C21H18BrClF3N3O/c1-3-10-20(2)12-29(19(30)27-15-7-5-14(22)6-8-15)28-18(20)13-4-9-16(17(23)11-13)21(24,25)26/h3-9,11H,1,10,12H2,2H3,(H,27,30) |
| InChIKey | WSIPETUBXWTCAA-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.75 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|