C17H24N2O2S — CID 19855138
methyl 4-[[N-(cyclohexylmethyl)-C-methylsulfanylcarbonimidoyl]amino]benzoate (PubChem CID 19855138) has the molecular formula C17H24N2O2S and a molecular weight of 320.46 g/mol. Its IUPAC name is methyl 4-[[N-(cyclohexylmethyl)-C-methylsulfanylcarbonimidoyl]amino]benzoate.
| Compound Name | methyl 4-[[N-(cyclohexylmethyl)-C-methylsulfanylcarbonimidoyl]amino]benzoate |
|---|---|
| PubChem CID | 19855138 |
| Molecular Formula | C17H24N2O2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | methyl 4-[[N-(cyclohexylmethyl)-C-methylsulfanylcarbonimidoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(N/C(=N/CC2CCCCC2)SC)cc1 |
| InChI | InChI=1S/C17H24N2O2S/c1-21-16(20)14-8-10-15(11-9-14)19-17(22-2)18-12-13-6-4-3-5-7-13/h8-11,13H,3-7,12H2,1-2H3,(H,18,19) |
| InChIKey | YHTOCGHYWOUNND-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|