About tripotassium;borate;sulfite
tripotassium;borate;sulfite (PubChem CID 19858262) has the molecular formula BK3O6S-2
and a molecular weight of 256.17 g/mol. Its IUPAC name is tripotassium;borate;sulfite.
Molecular Properties
| Compound Name | tripotassium;borate;sulfite |
| PubChem CID | 19858262 |
| Molecular Formula | BK3O6S-2 |
| Molecular Weight | 256.17 g/mol |
| Exact Mass | 255.84 |
| IUPAC Name | tripotassium;borate;sulfite |
| SMILES | O=S([O-])[O-].[K+].[K+].[K+].[O-]B([O-])[O-] |
| InChI | InChI=1S/BO3.3K.H2O3S/c2-1(3)4;;;;1-4(2)3/h;;;;(H2,1,2,3)/q-3;3*+1;/p-2 |
| InChIKey | UQSGXGJERINUQA-UHFFFAOYSA-L |
| XLogP | -13.94 |
| TPSA | 132.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.17 |
| LogP ≤ 5 | -13.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze tripotassium;borate;sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tripotassium;borate;sulfite?
The IUPAC name of tripotassium;borate;sulfite (CID 19858262) is tripotassium;borate;sulfite.
What is the SMILES notation for tripotassium;borate;sulfite?
The canonical SMILES for tripotassium;borate;sulfite is O=S([O-])[O-].[K+].[K+].[K+].[O-]B([O-])[O-].
What is the InChIKey of tripotassium;borate;sulfite?
The InChIKey is UQSGXGJERINUQA-UHFFFAOYSA-L. The full InChI is InChI=1S/BO3.3K.H2O3S/c2-1(3)4;;;;1-4(2)3/h;;;;(H2,1,2,3)/q-3;3*+1;/p-2.
What are the key properties of tripotassium;borate;sulfite?
tripotassium;borate;sulfite has a molecular weight of 256.17 g/mol, XLogP of -13.94, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tripotassium;borate;sulfite is sourced from PubChem (CID 19858262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).