About 2-(4-ethylpiperazin-1-yl)-N,N-dimethylethanamine
2-(4-ethylpiperazin-1-yl)-N,N-dimethylethanamine (PubChem CID 19860274) has the molecular formula C10H23N3
and a molecular weight of 185.31 g/mol. Its IUPAC name is 2-(4-ethylpiperazin-1-yl)-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-(4-ethylpiperazin-1-yl)-N,N-dimethylethanamine |
| PubChem CID | 19860274 |
| Molecular Formula | C10H23N3 |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.19 |
| IUPAC Name | 2-(4-ethylpiperazin-1-yl)-N,N-dimethylethanamine |
| SMILES | CCN1CCN(CCN(C)C)CC1 |
| InChI | InChI=1S/C10H23N3/c1-4-12-7-9-13(10-8-12)6-5-11(2)3/h4-10H2,1-3H3 |
| InChIKey | IZHLTDZACYWRKP-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-ethylpiperazin-1-yl)-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethylpiperazin-1-yl)-N,N-dimethylethanamine?
The IUPAC name of 2-(4-ethylpiperazin-1-yl)-N,N-dimethylethanamine (CID 19860274) is 2-(4-ethylpiperazin-1-yl)-N,N-dimethylethanamine.
What is the SMILES notation for 2-(4-ethylpiperazin-1-yl)-N,N-dimethylethanamine?
The canonical SMILES for 2-(4-ethylpiperazin-1-yl)-N,N-dimethylethanamine is CCN1CCN(CCN(C)C)CC1.
What is the InChIKey of 2-(4-ethylpiperazin-1-yl)-N,N-dimethylethanamine?
The InChIKey is IZHLTDZACYWRKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23N3/c1-4-12-7-9-13(10-8-12)6-5-11(2)3/h4-10H2,1-3H3.
What are the key properties of 2-(4-ethylpiperazin-1-yl)-N,N-dimethylethanamine?
2-(4-ethylpiperazin-1-yl)-N,N-dimethylethanamine has a molecular weight of 185.31 g/mol, XLogP of 0.19, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethylpiperazin-1-yl)-N,N-dimethylethanamine is sourced from PubChem (CID 19860274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).