About bis(dihydroxy(oxo)phosphanium);2-methylsulfanylpyridine
bis(dihydroxy(oxo)phosphanium);2-methylsulfanylpyridine (PubChem CID 19865315) has the molecular formula C6H11NO6P2S+2
and a molecular weight of 287.17 g/mol. Its IUPAC name is bis(dihydroxy(oxo)phosphanium);2-methylsulfanylpyridine.
Molecular Properties
| Compound Name | bis(dihydroxy(oxo)phosphanium);2-methylsulfanylpyridine |
| PubChem CID | 19865315 |
| Molecular Formula | C6H11NO6P2S+2 |
| Molecular Weight | 287.17 g/mol |
| Exact Mass | 286.98 |
| IUPAC Name | bis(dihydroxy(oxo)phosphanium);2-methylsulfanylpyridine |
| SMILES | CSc1ccccn1.O=[P+](O)O.O=[P+](O)O |
| InChI | InChI=1S/C6H7NS.2HO3P/c1-8-6-4-2-3-5-7-6;2*1-4(2)3/h2-5H,1H3;2*(H-,1,2,3)/p+2 |
| InChIKey | RLALNOIRJGZXSP-UHFFFAOYSA-P |
| XLogP | 1.06 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.17 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(dihydroxy(oxo)phosphanium);2-methylsulfanylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(dihydroxy(oxo)phosphanium);2-methylsulfanylpyridine?
The IUPAC name of bis(dihydroxy(oxo)phosphanium);2-methylsulfanylpyridine (CID 19865315) is bis(dihydroxy(oxo)phosphanium);2-methylsulfanylpyridine.
What is the SMILES notation for bis(dihydroxy(oxo)phosphanium);2-methylsulfanylpyridine?
The canonical SMILES for bis(dihydroxy(oxo)phosphanium);2-methylsulfanylpyridine is CSc1ccccn1.O=[P+](O)O.O=[P+](O)O.
What is the InChIKey of bis(dihydroxy(oxo)phosphanium);2-methylsulfanylpyridine?
The InChIKey is RLALNOIRJGZXSP-UHFFFAOYSA-P. The full InChI is InChI=1S/C6H7NS.2HO3P/c1-8-6-4-2-3-5-7-6;2*1-4(2)3/h2-5H,1H3;2*(H-,1,2,3)/p+2.
What are the key properties of bis(dihydroxy(oxo)phosphanium);2-methylsulfanylpyridine?
bis(dihydroxy(oxo)phosphanium);2-methylsulfanylpyridine has a molecular weight of 287.17 g/mol, XLogP of 1.06, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(dihydroxy(oxo)phosphanium);2-methylsulfanylpyridine is sourced from PubChem (CID 19865315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).