C13H15NO4 — CID 19866797
(4-methoxyphenyl)-(1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-yl)methanone (PubChem CID 19866797) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is (4-methoxyphenyl)-(1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-yl)methanone.
| Compound Name | (4-methoxyphenyl)-(1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-yl)methanone |
|---|---|
| PubChem CID | 19866797 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | (4-methoxyphenyl)-(1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazol-7a-yl)methanone |
| SMILES | COc1ccc(C(=O)C23COCN2COC3)cc1 |
| InChI | InChI=1S/C13H15NO4/c1-16-11-4-2-10(3-5-11)12(15)13-6-17-8-14(13)9-18-7-13/h2-5H,6-9H2,1H3 |
| InChIKey | HGFBKLMLJCALLK-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |