About 4-ethyl-2-methylbenzene-1,3-diamine
4-ethyl-2-methylbenzene-1,3-diamine (PubChem CID 19869829) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 4-ethyl-2-methylbenzene-1,3-diamine.
Molecular Properties
| Compound Name | 4-ethyl-2-methylbenzene-1,3-diamine |
| PubChem CID | 19869829 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 4-ethyl-2-methylbenzene-1,3-diamine |
| SMILES | CCc1ccc(N)c(C)c1N |
| InChI | InChI=1S/C9H14N2/c1-3-7-4-5-8(10)6(2)9(7)11/h4-5H,3,10-11H2,1-2H3 |
| InChIKey | YBDWNQKQXGUAOR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-2-methylbenzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2-methylbenzene-1,3-diamine?
The IUPAC name of 4-ethyl-2-methylbenzene-1,3-diamine (CID 19869829) is 4-ethyl-2-methylbenzene-1,3-diamine.
What is the SMILES notation for 4-ethyl-2-methylbenzene-1,3-diamine?
The canonical SMILES for 4-ethyl-2-methylbenzene-1,3-diamine is CCc1ccc(N)c(C)c1N.
What is the InChIKey of 4-ethyl-2-methylbenzene-1,3-diamine?
The InChIKey is YBDWNQKQXGUAOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2/c1-3-7-4-5-8(10)6(2)9(7)11/h4-5H,3,10-11H2,1-2H3.
What are the key properties of 4-ethyl-2-methylbenzene-1,3-diamine?
4-ethyl-2-methylbenzene-1,3-diamine has a molecular weight of 150.22 g/mol, XLogP of 1.72, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2-methylbenzene-1,3-diamine is sourced from PubChem (CID 19869829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).