About 2-(4,5-diphenyl-1H-imidazol-2-yl)-1-(2-methoxyphenyl)-4,5-diphenylimidazole
2-(4,5-diphenyl-1H-imidazol-2-yl)-1-(2-methoxyphenyl)-4,5-diphenylimidazole (PubChem CID 19870296) has the molecular formula C37H28N4O
and a molecular weight of 544.66 g/mol. Its IUPAC name is 2-(4,5-diphenyl-1H-imidazol-2-yl)-1-(2-methoxyphenyl)-4,5-diphenylimidazole.
Molecular Properties
| Compound Name | 2-(4,5-diphenyl-1H-imidazol-2-yl)-1-(2-methoxyphenyl)-4,5-diphenylimidazole |
| PubChem CID | 19870296 |
| Molecular Formula | C37H28N4O |
| Molecular Weight | 544.66 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | 2-(4,5-diphenyl-1H-imidazol-2-yl)-1-(2-methoxyphenyl)-4,5-diphenylimidazole |
| SMILES | COc1ccccc1-n1c(-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C37H28N4O/c1-42-31-25-15-14-24-30(31)41-35(29-22-12-5-13-23-29)34(28-20-10-4-11-21-28)40-37(41)36-38-32(26-16-6-2-7-17-26)33(39-36)27-18-8-3-9-19-27/h2-25H,1H3,(H,38,39) |
| InChIKey | DZBSFPLPBIVBAJ-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 544.66 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,5-diphenyl-1H-imidazol-2-yl)-1-(2-methoxyphenyl)-4,5-diphenylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-diphenyl-1H-imidazol-2-yl)-1-(2-methoxyphenyl)-4,5-diphenylimidazole?
The IUPAC name of 2-(4,5-diphenyl-1H-imidazol-2-yl)-1-(2-methoxyphenyl)-4,5-diphenylimidazole (CID 19870296) is 2-(4,5-diphenyl-1H-imidazol-2-yl)-1-(2-methoxyphenyl)-4,5-diphenylimidazole.
What is the SMILES notation for 2-(4,5-diphenyl-1H-imidazol-2-yl)-1-(2-methoxyphenyl)-4,5-diphenylimidazole?
The canonical SMILES for 2-(4,5-diphenyl-1H-imidazol-2-yl)-1-(2-methoxyphenyl)-4,5-diphenylimidazole is COc1ccccc1-n1c(-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)nc(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of 2-(4,5-diphenyl-1H-imidazol-2-yl)-1-(2-methoxyphenyl)-4,5-diphenylimidazole?
The InChIKey is DZBSFPLPBIVBAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C37H28N4O/c1-42-31-25-15-14-24-30(31)41-35(29-22-12-5-13-23-29)34(28-20-10-4-11-21-28)40-37(41)36-38-32(26-16-6-2-7-17-26)33(39-36)27-18-8-3-9-19-27/h2-25H,1H3,(H,38,39).
What are the key properties of 2-(4,5-diphenyl-1H-imidazol-2-yl)-1-(2-methoxyphenyl)-4,5-diphenylimidazole?
2-(4,5-diphenyl-1H-imidazol-2-yl)-1-(2-methoxyphenyl)-4,5-diphenylimidazole has a molecular weight of 544.66 g/mol, XLogP of 8.94, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-diphenyl-1H-imidazol-2-yl)-1-(2-methoxyphenyl)-4,5-diphenylimidazole is sourced from PubChem (CID 19870296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).