C37H28N4O — CID 19870296
2-(4,5-diphenyl-1H-imidazol-2-yl)-1-(2-methoxyphenyl)-4,5-diphenylimidazole (PubChem CID 19870296) has the molecular formula C37H28N4O and a molecular weight of 544.66 g/mol. Its IUPAC name is 2-(4,5-diphenyl-1H-imidazol-2-yl)-1-(2-methoxyphenyl)-4,5-diphenylimidazole.
| Compound Name | 2-(4,5-diphenyl-1H-imidazol-2-yl)-1-(2-methoxyphenyl)-4,5-diphenylimidazole |
|---|---|
| PubChem CID | 19870296 |
| Molecular Formula | C37H28N4O |
| Molecular Weight | 544.66 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | 2-(4,5-diphenyl-1H-imidazol-2-yl)-1-(2-methoxyphenyl)-4,5-diphenylimidazole |
| SMILES | COc1ccccc1-n1c(-c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)nc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C37H28N4O/c1-42-31-25-15-14-24-30(31)41-35(29-22-12-5-13-23-29)34(28-20-10-4-11-21-28)40-37(41)36-38-32(26-16-6-2-7-17-26)33(39-36)27-18-8-3-9-19-27/h2-25H,1H3,(H,38,39) |
| InChIKey | DZBSFPLPBIVBAJ-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.66 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imidazole_A(19)', 'substructure': 'N/A'} |
|---|