C34H37N3O5S — CID 19870628
3-methoxy-4-[[5-[(Z)-2-methyl-3-oxo-3-(propylamino)prop-1-enyl]-1-prop-2-enylindol-3-yl]methyl]-N-(2-methylphenyl)sulfonylbenzamide (PubChem CID 19870628) has the molecular formula C34H37N3O5S and a molecular weight of 599.75 g/mol. Its IUPAC name is 3-methoxy-4-[[5-[(Z)-2-methyl-3-oxo-3-(propylamino)prop-1-enyl]-1-prop-2-enylindol-3-yl]methyl]-N-(2-methylphenyl)sulfonylbenzamide.
| Compound Name | 3-methoxy-4-[[5-[(Z)-2-methyl-3-oxo-3-(propylamino)prop-1-enyl]-1-prop-2-enylindol-3-yl]methyl]-N-(2-methylphenyl)sulfonylbenzamide |
|---|---|
| PubChem CID | 19870628 |
| Molecular Formula | C34H37N3O5S |
| Molecular Weight | 599.75 g/mol |
| Exact Mass | 599.25 |
| IUPAC Name | 3-methoxy-4-[[5-[(Z)-2-methyl-3-oxo-3-(propylamino)prop-1-enyl]-1-prop-2-enylindol-3-yl]methyl]-N-(2-methylphenyl)sulfonylbenzamide |
| SMILES | C=CCn1cc(Cc2ccc(C(=O)NS(=O)(=O)c3ccccc3C)cc2OC)c2cc(/C=C(/C)C(=O)NCCC)ccc21 |
| InChI | InChI=1S/C34H37N3O5S/c1-6-16-35-33(38)24(4)18-25-12-15-30-29(19-25)28(22-37(30)17-7-2)20-26-13-14-27(21-31(26)42-5)34(39)36-43(40,41)32-11-9-8-10-23(32)3/h7-15,18-19,21-22H,2,6,16-17,20H2,1,3-5H3,(H,35,38)(H,36,39)/b24-18- |
| InChIKey | WEOWVHWPMOMXLV-MOHJPFBDSA-N |
| XLogP | 5.78 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.75 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|