C34H39BrFOP — CID 19870914
[2-(2-fluorononoxy)phenyl]methyl-triphenylphosphanium bromide (PubChem CID 19870914) has the molecular formula C34H39BrFOP and a molecular weight of 593.56 g/mol. Its IUPAC name is [2-(2-fluorononoxy)phenyl]methyl-triphenylphosphanium bromide.
| Compound Name | [2-(2-fluorononoxy)phenyl]methyl-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 19870914 |
| Molecular Formula | C34H39BrFOP |
| Molecular Weight | 593.56 g/mol |
| Exact Mass | 592.19 |
| IUPAC Name | [2-(2-fluorononoxy)phenyl]methyl-triphenylphosphanium bromide |
| SMILES | CCCCCCCC(F)COc1ccccc1C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C34H39FOP.BrH/c1-2-3-4-5-9-19-30(35)27-36-34-26-17-16-18-29(34)28-37(31-20-10-6-11-21-31,32-22-12-7-13-23-32)33-24-14-8-15-25-33;/h6-8,10-18,20-26,30H,2-5,9,19,27-28H2,1H3;1H/q+1;/p-1 |
| InChIKey | VXJYZFGWPFLBMA-UHFFFAOYSA-M |
| XLogP | 5.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.56 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|