C16H12O6S-2 — CID 19871378
4-(4-carboxylatophenyl)sulfonyl-2,3-dimethylbenzoate (PubChem CID 19871378) has the molecular formula C16H12O6S-2 and a molecular weight of 332.33 g/mol. Its IUPAC name is 4-(4-carboxylatophenyl)sulfonyl-2,3-dimethylbenzoate.
| Compound Name | 4-(4-carboxylatophenyl)sulfonyl-2,3-dimethylbenzoate |
|---|---|
| PubChem CID | 19871378 |
| Molecular Formula | C16H12O6S-2 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 4-(4-carboxylatophenyl)sulfonyl-2,3-dimethylbenzoate |
| SMILES | Cc1c(C(=O)[O-])ccc(S(=O)(=O)c2ccc(C(=O)[O-])cc2)c1C |
| InChI | InChI=1S/C16H14O6S/c1-9-10(2)14(8-7-13(9)16(19)20)23(21,22)12-5-3-11(4-6-12)15(17)18/h3-8H,1-2H3,(H,17,18)(H,19,20)/p-2 |
| InChIKey | OMPXVWAUARDUTD-UHFFFAOYSA-L |
| XLogP | -0.14 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |