C6H12N6 — CID 19871397
1-prop-2-enyl-2H-1,3,5-triazine-2,4,6-triamine (PubChem CID 19871397) has the molecular formula C6H12N6 and a molecular weight of 168.20 g/mol. Its IUPAC name is 1-prop-2-enyl-2H-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 1-prop-2-enyl-2H-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 19871397 |
| Molecular Formula | C6H12N6 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.11 |
| IUPAC Name | 1-prop-2-enyl-2H-1,3,5-triazine-2,4,6-triamine |
| SMILES | C=CCN1C(N)=NC(N)=NC1N |
| InChI | InChI=1S/C6H12N6/c1-2-3-12-5(8)10-4(7)11-6(12)9/h2,5H,1,3,8H2,(H4,7,9,10,11) |
| InChIKey | INTXTLRYCPTCKR-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 106.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|