C8H15N2+ — CID 19871527
5-methyl-2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-5-ium (PubChem CID 19871527) has the molecular formula C8H15N2+ and a molecular weight of 139.22 g/mol. Its IUPAC name is 5-methyl-2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-5-ium.
| Compound Name | 5-methyl-2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-5-ium |
|---|---|
| PubChem CID | 19871527 |
| Molecular Formula | C8H15N2+ |
| Molecular Weight | 139.22 g/mol |
| Exact Mass | 139.12 |
| IUPAC Name | 5-methyl-2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-5-ium |
| SMILES | C[N+]12CCCN=C1CCC2 |
| InChI | InChI=1S/C8H15N2/c1-10-6-2-4-8(10)9-5-3-7-10/h2-7H2,1H3/q+1 |
| InChIKey | BBULQGQOZLIJPJ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.22 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|