C7H11LiN2 — CID 134940683
lithium 2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-8-ide (PubChem CID 134940683) has the molecular formula C7H11LiN2 and a molecular weight of 130.12 g/mol. Its IUPAC name is lithium 2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-8-ide.
| Compound Name | lithium 2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-8-ide |
|---|---|
| PubChem CID | 134940683 |
| Molecular Formula | C7H11LiN2 |
| Molecular Weight | 130.12 g/mol |
| Exact Mass | 130.11 |
| IUPAC Name | lithium 2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-8-ide |
| SMILES | [CH-]1CCN2CCCN=C12.[Li+] |
| InChI | InChI=1S/C7H11N2.Li/c1-3-7-8-4-2-6-9(7)5-1;/h3H,1-2,4-6H2;/q-1;+1 |
| InChIKey | ULXSJPCOPPBNRS-UHFFFAOYSA-N |
| XLogP | -2.30 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.12 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|