C11H20N2O2 — CID 19872356
N-[1-(3,5-dimethylmorpholin-4-yl)ethyl]prop-2-enamide (PubChem CID 19872356) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is N-[1-(3,5-dimethylmorpholin-4-yl)ethyl]prop-2-enamide.
| Compound Name | N-[1-(3,5-dimethylmorpholin-4-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 19872356 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | N-[1-(3,5-dimethylmorpholin-4-yl)ethyl]prop-2-enamide |
| SMILES | C=CC(=O)NC(C)N1C(C)COCC1C |
| InChI | InChI=1S/C11H20N2O2/c1-5-11(14)12-10(4)13-8(2)6-15-7-9(13)3/h5,8-10H,1,6-7H2,2-4H3,(H,12,14) |
| InChIKey | OMQKKVSNWIAIHI-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|